cas: 29169-64-0 — see every product listed under this CAS number, including other names
(R)-2-Chloro-2-oxo-1-phenylethyl formate (CAS 29169-64-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242345-5G |
| cas | 29169-64-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 25g | 445.69 Pln |
| delivery time | 3-4 weeks |
|---|
[(1R)-2-chloro-2-oxo-1-phenylethyl] formate (CAS 29169-64-0) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: [(1R)-2-chloro-2-oxo-1-phenylethyl] formate. InChIKey: ZNLABNPTWSKGDX-MRVPVSSYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | [(1R)-2-chloro-2-oxo-1-phenylethyl] formate |
| InChIKey | ZNLABNPTWSKGDX-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)Cl)OC=O |
Computed by PubChem (NCBI)