CAS 115382-35-9 appears in our catalog under these names: 4-Acetyl-2-chlorobenzoic acid, 95%, 4-Acetyl-2-chloro-benzoic acid, 97%, 97%, 4-Acetyl-2-chlorobenzoic acid, 97%, 4-Acetyl-2-chlorobenzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-acetyl-2-chlorobenzoic acid (CAS 115382-35-9) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 4-acetyl-2-chlorobenzoic acid. InChIKey: KASJLCWKGSURCV-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 4-acetyl-2-chlorobenzoic acid |
| InChIKey | KASJLCWKGSURCV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)