cas: 63250-86-2 — see every product listed under this CAS number, including other names
(R)-3,3'-Dimethoxy-[1,1'-binaphthalene]-2,2'-diol 97% (CAS 63250-86-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1220070-50mg |
| cas | 63250-86-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 759.75 Pln | |
| Ambeed | 100mg | 1138.00 Pln | |
| Ambeed | 250mg | 2267.19 Pln | |
| Ambeed | 1g | 7167.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1220070 |
1-(2-hydroxy-3-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-ol (CAS 63250-86-2) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 1-(2-hydroxy-3-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-ol. InChIKey: DTMPNHYCCYOTJD-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-(2-hydroxy-3-methoxynaphthalen-1-yl)-3-methoxynaphthalen-2-ol |
| InChIKey | DTMPNHYCCYOTJD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C(=C1O)C3=C(C(=CC4=CC=CC=C43)OC)O |
Computed by PubChem (NCBI)