CAS 19851-61-7 appears in our catalog under these names: Dibenzyl terephthalate, 95%, Dibenzyl Terephthalate, Dibenzyl Terephthalate, >95% (HPLC), Terephthalic acid dibenzyl ester, Terephthalic acid dibenzyl ester, min. 95 %, 10 g. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Roth. Available pack sizes: 1g, 25g, 5g, on request, 250mg, 50mg, 10g, 50g.
Dibenzyl benzene-1,4-dicarboxylate (CAS 19851-61-7) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: dibenzyl benzene-1,4-dicarboxylate. InChIKey: IWGFEQWCMAADJZ-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | dibenzyl benzene-1,4-dicarboxylate |
| InChIKey | IWGFEQWCMAADJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)