CAS 148324-47-4 appears in our catalog under these names: 2–(4–(Benzyloxy)styryl)–6–hydroxybenzoic acid, (E)-2-(4-(Benzyloxy)styryl)-6-hydroxybenzoic acid, 95%, 2-(4-(Benzyloxy)styryl)-6-hydroxybenzoic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-hydroxy-6-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzoic acid (CAS 148324-47-4) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 2-hydroxy-6-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzoic acid. InChIKey: VWZWUULAXUNKKP-FMIVXFBMSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-hydroxy-6-[(E)-2-(4-phenylmethoxyphenyl)ethenyl]benzoic acid |
| InChIKey | VWZWUULAXUNKKP-FMIVXFBMSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C3=C(C(=CC=C3)O)C(=O)O |
Computed by PubChem (NCBI)