Products 16308-63-7

CAS 16308-63-7 is the registry number for 1,4-dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate (CAS 16308-63-7) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate. InChIKey: MPJYZGXACATOPK-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18O4
Molecular weight346.4 g/mol
IUPAC namedimethyl 2,5-diphenylbenzene-1,4-dicarboxylate
InChIKeyMPJYZGXACATOPK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1C2=CC=CC=C2)C(=O)OC)C3=CC=CC=C3

Computed by PubChem (NCBI)