CAS 16308-63-7 is the registry number for 1,4-dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate (CAS 16308-63-7) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate. InChIKey: MPJYZGXACATOPK-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | dimethyl 2,5-diphenylbenzene-1,4-dicarboxylate |
| InChIKey | MPJYZGXACATOPK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C2=CC=CC=C2)C(=O)OC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)