Products 1609647-50-8

CAS 1609647-50-8 is the registry number for 2',5'-Dimethyl-[1,1':4',1''-terphenyl]-3,3''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[4-(3-carboxyphenyl)-2,5-dimethylphenyl]benzoic acid (CAS 1609647-50-8) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: 3-[4-(3-carboxyphenyl)-2,5-dimethylphenyl]benzoic acid. InChIKey: GBCPXDPWPDDHSA-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18O4
Molecular weight346.4 g/mol
IUPAC name3-[4-(3-carboxyphenyl)-2,5-dimethylphenyl]benzoic acid
InChIKeyGBCPXDPWPDDHSA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C2=CC(=CC=C2)C(=O)O)C)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)