cas: 331763-56-5 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-4-(3-chlorophenyl)butanoic acid, 96% (CAS 331763-56-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241446-100MG |
| cas | 331763-56-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 2403.34 Pln | |
| Fluorochem | 10g | 4027.77 Pln | |
| Fluorochem | 25g | 8573.04 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-4-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 331763-56-5) is a chemical compound with the molecular formula C15H20ClNO4 and a molecular weight of 313.77 g/mol. IUPAC name: (3R)-4-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: APXVJJBVNYZEDD-GFCCVEGCSA-N.
| Molecular formula | C15H20ClNO4 |
|---|---|
| Molecular weight | 313.77 g/mol |
| IUPAC name | (3R)-4-(3-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | APXVJJBVNYZEDD-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)Cl)CC(=O)O |
Computed by PubChem (NCBI)