cas: 331763-66-7 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-4-(3-fluorophenyl)butanoic acid, 98% (CAS 331763-66-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213065-1G |
| cas | 331763-66-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 758.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3R)-4-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 331763-66-7) is a chemical compound with the molecular formula C15H20FNO4 and a molecular weight of 297.32 g/mol. IUPAC name: (3R)-4-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: ZKVPDNJRPDEQCZ-GFCCVEGCSA-N.
| Molecular formula | C15H20FNO4 |
|---|---|
| Molecular weight | 297.32 g/mol |
| IUPAC name | (3R)-4-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | ZKVPDNJRPDEQCZ-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)F)CC(=O)O |
Computed by PubChem (NCBI)