(R)-3-(1-Aminoethyl)-2-methylbenzonitrile hydrochloride, 95%
cas: 2803932-38-7 — see every product listed under this CAS number, including other names
(R)-3-(1-Aminoethyl)-2-methylbenzonitrile hydrochloride, 95% (CAS 2803932-38-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1549338-100mg |
| cas | 2803932-38-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 475.41 Pln | |
| BLDpharm | 1g | 1141.84 Pln | |
| Chemat | 25mg | 606.80 Pln | |
| Chemat | 50mg | 976.40 Pln | |
| Chemat | 100mg | 1682.00 Pln | |
| Chemat | 250mg | 3304.40 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1101.71 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-[(1R)-1-aminoethyl]-2-methylbenzonitrile;hydrochloride (CAS 2803932-38-7) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 3-[(1R)-1-aminoethyl]-2-methylbenzonitrile;hydrochloride. InChIKey: YATXEDQNQZCNJD-DDWIOCJRSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 3-[(1R)-1-aminoethyl]-2-methylbenzonitrile;hydrochloride |
| InChIKey | YATXEDQNQZCNJD-DDWIOCJRSA-N |
| SMILES | CC1=C(C=CC=C1[C@@H](C)N)C#N.Cl |
Computed by PubChem (NCBI)