CAS 91517-25-8 appears in our catalog under these names: 2-(4-Chlorophenyl)piperazine, 95%, 2-(4-Chlorophenyl)piperazine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(4-chlorophenyl)piperazine (CAS 91517-25-8) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-(4-chlorophenyl)piperazine. InChIKey: OTOVNNDSINVUBR-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)piperazine |
| InChIKey | OTOVNNDSINVUBR-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)