Products 343-94-2
CAS 343-94-2 appears in our catalog under these names: Tryptamine hydrochloride, 98%, Tryptamine Hydrochloride, >95% (HPLC), Tryptamine hydrochloride/ 98+%, Tryptamine (hydrochloride), Tryptamine hydrochloride, 98+% . Offered by: Combi-blocks, TRC, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g, 5g, 2,5g, 250mg, 500mg, 10g, 50g.
2-(1H-indol-3-yl)ethanamine;hydrochloride (CAS 343-94-2) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-(1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: KDFBGNBTTMPNIG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | KDFBGNBTTMPNIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)
Synonyms:
Tryptamine hydrochloride, 3-(2-Aminoethyl)indole hydrochloride, Tryptamine monohydrochloride, 2-(1H-indol-3-yl)ethanamine hydrochloride, 1H-Indole-3-ethanamine, monohydrochloride, 3-(2-Aminoethyl)-1H-indole monohydrochloride, Tryptamine (hydrochloride), 2-(1H-indol-3-yl)ethanamine;hydrochloride, 1H-Indole-3-ethanamine HCl, 2-indol-3-ylethylamine, chloride