CAS 1253792-93-6 appears in our catalog under these names: (R)-3-(1-Aminopropyl)benzonitrile hydrochloride, 95%, (R)–3–(1–Aminopropyl)benzonitrile hydrochloride, (R)-3-(1-Aminopropyl)benzonitrile hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
3-[(1R)-1-aminopropyl]benzonitrile;hydrochloride (CAS 1253792-93-6) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 3-[(1R)-1-aminopropyl]benzonitrile;hydrochloride. InChIKey: XTSNURVDNKGGJE-HNCPQSOCSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 3-[(1R)-1-aminopropyl]benzonitrile;hydrochloride |
| InChIKey | XTSNURVDNKGGJE-HNCPQSOCSA-N |
| SMILES | CC[C@H](C1=CC=CC(=C1)C#N)N.Cl |
Computed by PubChem (NCBI)