CAS 1155019-81-0 is the registry number for 2-Chloro-n-(1-cyclopropylethyl)pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-chloro-N-(1-cyclopropylethyl)pyridin-3-amine (CAS 1155019-81-0) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-chloro-N-(1-cyclopropylethyl)pyridin-3-amine. InChIKey: VIFFCDPMMGPGKY-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-chloro-N-(1-cyclopropylethyl)pyridin-3-amine |
| InChIKey | VIFFCDPMMGPGKY-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)NC2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)