CAS 373368-68-4 appears in our catalog under these names: (R)-3-(4-(Benzyloxy)Phenyl)-2-Hydroxypropanoic Acid, 95%, 95%, (R)-3-(4-(Benzyloxy)phenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg.
(2R)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 373368-68-4) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (2R)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: RADJEIZOJZINJB-OAHLLOKOSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | (2R)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | RADJEIZOJZINJB-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@H](C(=O)O)O |
Computed by PubChem (NCBI)