CAS 122294-03-5 is the registry number for methyl 4-(3,4-dimethoxyphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-(3,4-dimethoxyphenyl)benzoate (CAS 122294-03-5) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: methyl 4-(3,4-dimethoxyphenyl)benzoate. InChIKey: MVDHOJUHRYPXIP-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | methyl 4-(3,4-dimethoxyphenyl)benzoate |
| InChIKey | MVDHOJUHRYPXIP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=C(C=C2)C(=O)OC)OC |
Computed by PubChem (NCBI)