Products 938275-66-2
CAS 938275-66-2 appears in our catalog under these names: 3-Methoxy-4-[(3-methylbenzyl)oxy]benzoic acid, 95%, 3-Methoxy-4-((3-methylbenzyl)oxy)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 5g, 1g.
3-methoxy-4-[(3-methylphenyl)methoxy]benzoic acid (CAS 938275-66-2) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 3-methoxy-4-[(3-methylphenyl)methoxy]benzoic acid. InChIKey: GXKAZCBDYCYSBE-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 3-methoxy-4-[(3-methylphenyl)methoxy]benzoic acid |
| InChIKey | GXKAZCBDYCYSBE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)COC2=C(C=C(C=C2)C(=O)O)OC |
Computed by PubChem (NCBI)