CAS 162919-37-1 appears in our catalog under these names: (S)-3-(4-(Benzyloxy)phenyl)-2-hydroxypropanoic acid, 97%, (S)-3-(4-(Benzyloxy)phenyl)-2-hydroxypropanoic acid, 95%, 95%, (S)-3-(4'-Benzyloxyphenyl)-2-hydroxy-propionic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g.
(2S)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 162919-37-1) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (2S)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: RADJEIZOJZINJB-HNNXBMFYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | (2S)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | RADJEIZOJZINJB-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)