CAS 1437794-61-0 is the registry number for Methyl 4-(2,5-dimethoxyphenyl)benzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(2,5-dimethoxyphenyl)benzoate (CAS 1437794-61-0) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: methyl 4-(2,5-dimethoxyphenyl)benzoate. InChIKey: JVAICMIBPIISCY-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | methyl 4-(2,5-dimethoxyphenyl)benzoate |
| InChIKey | JVAICMIBPIISCY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)