(R)-3-(Boc-Amino)-2-(Fmoc-amino)propionic acid, 95%, 95%
cas: 198544-42-2 — see every product listed under this CAS number, including other names
(R)-3-(Boc-Amino)-2-(Fmoc-amino)propionic acid, 95%, 95% (CAS 198544-42-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1kg, 5kg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BKY-50g |
| cas | 198544-42-2 |
| size | 50g |
| availability | 5000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1029.20 Pln | |
| Chemat | 1kg | 7888.40 Pln | |
| Chemat | 5kg | 38126.40 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 261.20 Pln | |
| Chemat | 25g | 558.80 Pln | |
| Chemat | 100g | 1922.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 198544-42-2) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PKAUMAVONPSDRW-LJQANCHMSA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PKAUMAVONPSDRW-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-D-Dap(Boc)-OH, 3-(Boc-amino)-N-Fmoc-D-alanine, Fmoc-D-Dpr(Boc)-OH, (R)-3-(Boc-Amino)-2-(Fmoc-amino)propionic acid, Fmoc-N-beta-Boc-D-2,3-diaminopropionic acid, Fmoc-N3-Boc-D-2,3-diaminopropionic acid, PKAUMAVONPSDRW-LJQANCHMSA-N, Fmoc-D-Dapa(Boc)-OH, Fmoc-Dap(Boc)-OH hydrate, orb2663640