cas: 198544-42-2 — see every product listed under this CAS number, including other names
Fmoc–D–Dap(Boc)–OH (CAS 198544-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 100g, 25g, 5g, 50g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA21611-1000 |
| cas | 198544-42-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 976.16 Pln | |
| GLPBio | 10g | 1261.67 Pln | |
| GLPBio | 100g | 2871.76 Pln | |
| GLPBio | 25g | 1659.51 Pln | |
| GLPBio | 5g | 1116.58 Pln | |
| GLPBio | 50g | 2127.56 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 198544-42-2) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PKAUMAVONPSDRW-LJQANCHMSA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PKAUMAVONPSDRW-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)