Fmoc-D-Dap(Boc)-OH, 99.56%
cas: 198544-42-2 — see every product listed under this CAS number, including other names
Fmoc-D-Dap(Boc)-OH, 99.56% (CAS 198544-42-2) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g, 50 g, 5 g, 10 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W046355-25 g |
| cas | 198544-42-2 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 1104.53 Pln | |
| MedChemExpress | 100 g | 2637.05 Pln | |
| MedChemExpress | 50 g | 1694.32 Pln | |
| MedChemExpress | 5 g | 417.22 Pln | |
| MedChemExpress | 10 g | 598.33 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.56% |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 198544-42-2) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PKAUMAVONPSDRW-LJQANCHMSA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PKAUMAVONPSDRW-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-D-Dap(Boc)-OH, 3-(Boc-amino)-N-Fmoc-D-alanine, Fmoc-D-Dpr(Boc)-OH, (R)-3-(Boc-Amino)-2-(Fmoc-amino)propionic acid, Fmoc-N-beta-Boc-D-2,3-diaminopropionic acid, Fmoc-N3-Boc-D-2,3-diaminopropionic acid, PKAUMAVONPSDRW-LJQANCHMSA-N, Fmoc-D-Dapa(Boc)-OH, Fmoc-Dap(Boc)-OH hydrate, orb2663640