cas: 1430086-53-5 — see every product listed under this CAS number, including other names
(R)-3-(Trifluoromethyl)morpholine hydrochloride, 97% (CAS 1430086-53-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F620875-50MG |
| cas | 1430086-53-5 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 903.87 Pln | |
| Fluorochem | 100mg | 1320.39 Pln | |
| Fluorochem | 250mg | 2169.05 Pln | |
| Fluorochem | 1g | 5490.79 Pln | |
| Ambeed | 100mg | 1427.25 Pln | |
| Ambeed | 250mg | 2389.56 Pln | |
| Ambeed | 1g | 6071.94 Pln | |
| Ambeed | 5g | 18626.50 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3R)-3-(trifluoromethyl)morpholine;hydrochloride (CAS 1430086-53-5) is a chemical compound with the molecular formula C5H9ClF3NO and a molecular weight of 191.58 g/mol. IUPAC name: (3R)-3-(trifluoromethyl)morpholine;hydrochloride. InChIKey: OHFRHIUJBMHGLQ-PGMHMLKASA-N.
| Molecular formula | C5H9ClF3NO |
|---|---|
| Molecular weight | 191.58 g/mol |
| IUPAC name | (3R)-3-(trifluoromethyl)morpholine;hydrochloride |
| InChIKey | OHFRHIUJBMHGLQ-PGMHMLKASA-N |
| SMILES | C1COC[C@@H](N1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)