Products 2193052-15-0
CAS 2193052-15-0 appears in our catalog under these names: (S)-3-(Trifluoromethyl)morpholine hydrochloride, 98%, (S)-3-(Trifluoromethyl)morpholine hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g.
(3S)-3-(trifluoromethyl)morpholine;hydrochloride (CAS 2193052-15-0) is a chemical compound with the molecular formula C5H9ClF3NO and a molecular weight of 191.58 g/mol. IUPAC name: (3S)-3-(trifluoromethyl)morpholine;hydrochloride. InChIKey: OHFRHIUJBMHGLQ-WCCKRBBISA-N.
| Molecular formula | C5H9ClF3NO |
|---|---|
| Molecular weight | 191.58 g/mol |
| IUPAC name | (3S)-3-(trifluoromethyl)morpholine;hydrochloride |
| InChIKey | OHFRHIUJBMHGLQ-WCCKRBBISA-N |
| SMILES | C1COC[C@H](N1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)