cas: 450416-58-7 — see every product listed under this CAS number, including other names
(R)-3-Phenylpiperidine Hydrochloride, 95%, 95% (CAS 450416-58-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJQS-100mg |
| cas | 450416-58-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 635.60 Pln | |
| Chemat | 250mg | 1077.20 Pln | |
| Chemat | 1g | 2728.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-phenylpiperidine;hydrochloride (CAS 450416-58-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (3R)-3-phenylpiperidine;hydrochloride. InChIKey: OKVMJYYCFLIGFJ-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (3R)-3-phenylpiperidine;hydrochloride |
| InChIKey | OKVMJYYCFLIGFJ-MERQFXBCSA-N |
| SMILES | C1C[C@@H](CNC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)