cas: 450416-58-7 — see every product listed under this CAS number, including other names
(R)-3-Phenylpiperidine hydrochloride, 98% (CAS 450416-58-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A572431-10g |
| cas | 450416-58-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16826.74 Pln | |
| AmBeed | 5g | 10902.64 Pln | |
| AmBeed | 1g | 3624.46 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R)-3-phenylpiperidine;hydrochloride (CAS 450416-58-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (3R)-3-phenylpiperidine;hydrochloride. InChIKey: OKVMJYYCFLIGFJ-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (3R)-3-phenylpiperidine;hydrochloride |
| InChIKey | OKVMJYYCFLIGFJ-MERQFXBCSA-N |
| SMILES | C1C[C@@H](CNC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)