cas: 1229381-08-1 — see every product listed under this CAS number, including other names
(R)-4-TERT-BUTOXY-4-OXO-2-PHENYLBUTANOIC ACID, 95% (CAS 1229381-08-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301283-100MG |
| cas | 1229381-08-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 955.93 Pln | |
| Fluorochem | 1g | 2299.21 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid (CAS 1229381-08-1) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid. InChIKey: ICZBQHPMSPTRJO-LLVKDONJSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid |
| InChIKey | ICZBQHPMSPTRJO-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)