Products 7507-48-4
CAS 7507-48-4 appears in our catalog under these names: tert-Butylhydroquinone diacetate, 98%, 2-tert-butyl-1,4-phenylene diacetate, 98%, tert–Butylhydroquinone Diacetate, tert-Butylhydroquinone Diacetate, >97%, >97%, tert-Butylhydroquinone diacetate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
(4-acetyloxy-3-tert-butylphenyl) acetate (CAS 7507-48-4) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (4-acetyloxy-3-tert-butylphenyl) acetate. InChIKey: SJRALGDWZXRRKL-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (4-acetyloxy-3-tert-butylphenyl) acetate |
| InChIKey | SJRALGDWZXRRKL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)OC(=O)C)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
TERT-BUTYLHYDROQUINONE DIACETATE, 2-tert-Butyl-1,4-phenylene diacetate, (4-acetyloxy-3-tert-butylphenyl) acetate, tert-Butylhydroquinone, diacetate, 2-tert-Butyl-1,4-phenylenediacetate, (4-acetoxy-3-tert-butyl-phenyl) acetate, 4-acetyloxy-2-(tert-butyl)phenyl acetate, 1,4-Benzenediol-2-(1,1-dimethylethyl)-1,4-diacetate