CAS 6422-84-0 appears in our catalog under these names: Terephthalic acid diisopropyl ester, 95%, Diisopropyl terephthalate, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
Dipropan-2-yl benzene-1,4-dicarboxylate (CAS 6422-84-0) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: dipropan-2-yl benzene-1,4-dicarboxylate. InChIKey: HWUDSKSILZNHRX-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | dipropan-2-yl benzene-1,4-dicarboxylate |
| InChIKey | HWUDSKSILZNHRX-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=C(C=C1)C(=O)OC(C)C |
Computed by PubChem (NCBI)