Products 245323-38-0
CAS 245323-38-0 appears in our catalog under these names: (S)-4-tert-Butoxy-4-oxo-2-phenylbutanoic acid, 97%, (S)-4-(tert-Butoxy)-4-oxo-2-phenylbutanoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid (CAS 245323-38-0) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid. InChIKey: ICZBQHPMSPTRJO-NSHDSACASA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid |
| InChIKey | ICZBQHPMSPTRJO-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)