CAS 1229381-08-1 appears in our catalog under these names: (R)-4-tert-Butoxy-4-oxo-2-phenylbutanoic acid, 97%, (R)–4–(tert–Butoxy)–4–oxo–2–phenylbutanoic acid, (R)-4-(tert-Butoxy)-4-oxo-2-phenylbutanoic acid, 95%, 95%, (R)-4-TERT-BUTOXY-4-OXO-2-PHENYLBUTANOIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid (CAS 1229381-08-1) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid. InChIKey: ICZBQHPMSPTRJO-LLVKDONJSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2R)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-phenylbutanoic acid |
| InChIKey | ICZBQHPMSPTRJO-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)