cas: 1637453-85-0 — see every product listed under this CAS number, including other names
(R)-5-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride 95+% (CAS 1637453-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1192405-100mg |
| cas | 1637453-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 704.12 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2534.19 Pln | |
| Ambeed | 5g | 9287.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1192405 |
(1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637453-85-0) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: QFBRNSMZZDVAKR-HNCPQSOCSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | QFBRNSMZZDVAKR-HNCPQSOCSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@H](CC2)N.Cl |
Computed by PubChem (NCBI)