CAS 1637453-85-0 appears in our catalog under these names: (R)-5-Methoxy-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (R)–5–Methoxy–2,3–dihydro–1H–inden–1–amine hydrochloride, (R)-5-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, (R)-5-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 95+%, 95+%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg, 25mg, 500mg, 5g.
(1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637453-85-0) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: QFBRNSMZZDVAKR-HNCPQSOCSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | QFBRNSMZZDVAKR-HNCPQSOCSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@H](CC2)N.Cl |
Computed by PubChem (NCBI)