(R)-5-Phenylmorpholin-2-one, 97%
cas: 121269-45-2 — see every product listed under this CAS number, including other names
(R)-5-Phenylmorpholin-2-one, 97% (CAS 121269-45-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A413505-250mg |
| cas | 121269-45-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1482.88 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1379.60 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1469.51 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 2559.53 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(5R)-5-phenylmorpholin-2-one (CAS 121269-45-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (5R)-5-phenylmorpholin-2-one. InChIKey: CMYHFJFAHHKICH-VIFPVBQESA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (5R)-5-phenylmorpholin-2-one |
| InChIKey | CMYHFJFAHHKICH-VIFPVBQESA-N |
| SMILES | C1[C@H](NCC(=O)O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)