CAS 121269-45-2 appears in our catalog under these names: (R)-5-Phenylmorpholin-2-one 97%, (R)-5-phenylmorpholin-2-one, 97%, (R)-5-Phenylmorpholin-2-one, 97%, 97%, (5R)-3,4,5,6-Tetrahydro-5-phenyl-4(h)-1,4-oxazin-2-one, 95%. Offered by: Ambeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(5R)-5-phenylmorpholin-2-one (CAS 121269-45-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (5R)-5-phenylmorpholin-2-one. InChIKey: CMYHFJFAHHKICH-VIFPVBQESA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (5R)-5-phenylmorpholin-2-one |
| InChIKey | CMYHFJFAHHKICH-VIFPVBQESA-N |
| SMILES | C1[C@H](NCC(=O)O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)