cas: 53101-49-8 — see every product listed under this CAS number, including other names
(R)-6-Hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid, 99%, 99% (CAS 53101-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C6R-100mg |
| cas | 53101-49-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1158.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid (CAS 53101-49-8) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: (2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid. InChIKey: GLEVLJDDWXEYCO-CQSZACIVSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| InChIKey | GLEVLJDDWXEYCO-CQSZACIVSA-N |
| SMILES | CC1=C(C2=C(CC[C@](O2)(C)C(=O)O)C(=C1O)C)C |
Computed by PubChem (NCBI)