cas: 100858-34-2 — see every product listed under this CAS number, including other names
(R)-Benzyl 3-hydroxypiperidine-1-carboxylate 97% (CAS 100858-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119916-250mg |
| cas | 100858-34-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 10g | 426.00 Pln | |
| Ambeed | 25g | 798.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A119916 |
Benzyl (3R)-3-hydroxypiperidine-1-carboxylate (CAS 100858-34-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl (3R)-3-hydroxypiperidine-1-carboxylate. InChIKey: NDGWBAFATMSBHZ-GFCCVEGCSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl (3R)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | NDGWBAFATMSBHZ-GFCCVEGCSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)