cas: 100858-34-2 — see every product listed under this CAS number, including other names
(R)-Benzyl 3-hydroxypiperidine-1-carboxylate, 97%, 97% (CAS 100858-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111420-250mg |
| cas | 100858-34-2 |
| size | 250mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 587.60 Pln | |
| Chemat | 100g | 1864.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3R)-3-hydroxypiperidine-1-carboxylate (CAS 100858-34-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl (3R)-3-hydroxypiperidine-1-carboxylate. InChIKey: NDGWBAFATMSBHZ-GFCCVEGCSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl (3R)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | NDGWBAFATMSBHZ-GFCCVEGCSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)