cas: 132605-96-0 — see every product listed under this CAS number, including other names
(R)-Boc-β2-HoLeu-OH 97% (CAS 132605-96-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115022-50mg |
| cas | 132605-96-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 998.94 Pln | |
| Ambeed | 100mg | 1638.62 Pln | |
| Ambeed | 250mg | 2740.00 Pln | |
| Ambeed | 1g | 5715.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A115022 |
(2R)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoic acid (CAS 132605-96-0) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoic acid. InChIKey: WWKOREWJYZNXDX-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoic acid |
| InChIKey | WWKOREWJYZNXDX-SECBINFHSA-N |
| SMILES | CC(C)C[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)