CAS 132605-96-0 appears in our catalog under these names: (R)-2-(((tert-Butoxycarbonyl)amino)methyl)-4-methylpentanoic acid, 95%, (R)-2-(((tert-Butoxycarbonyl)amino)methyl)-4-methylpentanoic acid, 97%, 97%, (R)-2-(((tert-Butoxycarbonyl)amino)methyl)-4-methylpentanoic acid, 97%, (R)-Boc-β2-HoLeu-OH, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(2R)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoic acid (CAS 132605-96-0) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoic acid. InChIKey: WWKOREWJYZNXDX-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R)-4-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pentanoic acid |
| InChIKey | WWKOREWJYZNXDX-SECBINFHSA-N |
| SMILES | CC(C)C[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)