cas: 500-64-1 — see every product listed under this CAS number, including other names
(R)-Kavain, 99%, 99% (CAS 500-64-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDFU-1mg |
| cas | 500-64-1 |
| size | 1mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 122.00 Pln | |
| Chemat | 5mg | 184.40 Pln | |
| Chemat | 10mg | 256.40 Pln | |
| Chemat | 25mg | 443.60 Pln | |
| Chemat | 50mg | 702.80 Pln | |
| Chemat | 100mg | 1154.00 Pln | |
| Chemat | 250mg | 1917.20 Pln | |
| Chemat | 1g | 5075.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Kawain is an aromatic ether and a member of 2-pyranones.
Source: ChEBI
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2R)-4-methoxy-2-[(E)-2-phenylethenyl]-2,3-dihydropyran-6-one |
| InChIKey | XEAQIWGXBXCYFX-GUOLPTJISA-N |
| SMILES | COC1=CC(=O)O[C@H](C1)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)