Products 773874-20-7

CAS 773874-20-7 is the registry number for Methyl 2-ethoxy-1-naphthoate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-ethoxynaphthalene-1-carboxylate (CAS 773874-20-7) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: methyl 2-ethoxynaphthalene-1-carboxylate. InChIKey: NBJANJGBTWDFSM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O3
Molecular weight230.26 g/mol
IUPAC namemethyl 2-ethoxynaphthalene-1-carboxylate
InChIKeyNBJANJGBTWDFSM-UHFFFAOYSA-N
SMILESCCOC1=C(C2=CC=CC=C2C=C1)C(=O)OC

Computed by PubChem (NCBI)