Products 61495-42-9

CAS 61495-42-9 is the registry number for 2-(6-Hydroxy-naphthalen-2-yl)-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(6-hydroxynaphthalen-2-yl)propanoate (CAS 61495-42-9) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: methyl 2-(6-hydroxynaphthalen-2-yl)propanoate. InChIKey: RKDCLWDNCOUHGF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O3
Molecular weight230.26 g/mol
IUPAC namemethyl 2-(6-hydroxynaphthalen-2-yl)propanoate
InChIKeyRKDCLWDNCOUHGF-UHFFFAOYSA-N
SMILESCC(C1=CC2=C(C=C1)C=C(C=C2)O)C(=O)OC

Computed by PubChem (NCBI)