CAS 63628-25-1 appears in our catalog under these names: 2–Methoxy–2–(1–naphthyl)propionic Acid, 2-Methoxy-2-(1-naphthyl)propionic acid, 98%, 2-Methoxy-2-(1-naphthyl)propionic Acid, >98.0%(GC)(T), 2-Methoxy-2-(naphthalen-1-yl)propanoic acid, ≥97%, ≥97%, 2-Methoxy-2-(naphthalen-1-yl)propanoic acid, ≥97%. Offered by: GLPBio, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
2-methoxy-2-naphthalen-1-ylpropanoic acid (CAS 63628-25-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 2-methoxy-2-naphthalen-1-ylpropanoic acid. InChIKey: YVWMPILNFZOQSZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-methoxy-2-naphthalen-1-ylpropanoic acid |
| InChIKey | YVWMPILNFZOQSZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=CC=CC=C21)(C(=O)O)OC |
Computed by PubChem (NCBI)