Products 1279015-89-2

CAS 1279015-89-2 is the registry number for 2',3'-Dimethoxy-[1,1'-biphenyl]-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(2,3-dimethoxyphenyl)phenol (CAS 1279015-89-2) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 4-(2,3-dimethoxyphenyl)phenol. InChIKey: DYTLSYZTUIGVMD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O3
Molecular weight230.26 g/mol
IUPAC name4-(2,3-dimethoxyphenyl)phenol
InChIKeyDYTLSYZTUIGVMD-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1OC)C2=CC=C(C=C2)O

Computed by PubChem (NCBI)