cas: 32345-59-8 — see every product listed under this CAS number, including other names
(R)-Methyl 2-(2-Chlorophenyl)-2-Hydroxyacetate, 98%, 98% (CAS 32345-59-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKQ4-250mg |
| cas | 32345-59-8 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 587.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-(2-chlorophenyl)-2-hydroxyacetate (CAS 32345-59-8) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: methyl (2R)-2-(2-chlorophenyl)-2-hydroxyacetate. InChIKey: ZMPGBVQQIQSQED-MRVPVSSYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl (2R)-2-(2-chlorophenyl)-2-hydroxyacetate |
| InChIKey | ZMPGBVQQIQSQED-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)