CAS 19094-75-8 appears in our catalog under these names: 2-(2-Chloro-6-methylphenoxy)acetic acid, 95%, 2-(2-Chloro-6-methylphenoxy)acetic Acid, >95% (HPLC), 2-Chloro-6-methylphenoxyacetic acid, 2-(2-Chloro-6-methylphenoxy)acetic acid, 2-(2-Chloro-6-methylphenoxy)acetic acid, 98%. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 10mg, 50mg, 2,5g.
2-(2-chloro-6-methylphenoxy)acetic acid (CAS 19094-75-8) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(2-chloro-6-methylphenoxy)acetic acid. InChIKey: WHLKFTSLSDHFMU-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(2-chloro-6-methylphenoxy)acetic acid |
| InChIKey | WHLKFTSLSDHFMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)OCC(=O)O |
Computed by PubChem (NCBI)