CAS 13305-18-5 appears in our catalog under these names: Methyl 2-(3-chlorophenyl)-2-hydroxyacetate, 95%, Methyl 2-(3-chlorophenyl)-2-hydroxyacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g, 250mg.
Methyl 2-(3-chlorophenyl)-2-hydroxyacetate (CAS 13305-18-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 2-(3-chlorophenyl)-2-hydroxyacetate. InChIKey: CPEZVACFWJSZNE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 2-(3-chlorophenyl)-2-hydroxyacetate |
| InChIKey | CPEZVACFWJSZNE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)Cl)O |
Computed by PubChem (NCBI)