CAS 18093-05-5 appears in our catalog under these names: 2-Chloro-4,5-dimethoxybenzaldehyde, 95%, 2-Chloro-4,5-dimethoxybenzaldehyde, 97%, 2-Chloro-4,5-dimethoxybenzaldehyde, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 50mg.
2-chloro-4,5-dimethoxybenzaldehyde (CAS 18093-05-5) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-4,5-dimethoxybenzaldehyde. InChIKey: KTLBJNXLHDMIRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-4,5-dimethoxybenzaldehyde |
| InChIKey | KTLBJNXLHDMIRZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Cl)OC |
Computed by PubChem (NCBI)