CAS 23434-95-9 appears in our catalog under these names: 3-(4-Chlorophenyl)-2-hydroxypropionic Acid, ≥95%, ≥95%, 3-(4-Chlorophenyl)-2-hydroxypropionic acid, 95%, 3-(4-Chlorophenyl)-2-hydroxypropionic acid, ≥95%, 3-(4-Chlorophenyl)-2-hydroxypropionic acid. Offered by: Chemat, Combi-blocks, Fluorochem, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 0,5g.
3-(4-chlorophenyl)-2-hydroxypropanoic acid (CAS 23434-95-9) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-hydroxypropanoic acid. InChIKey: HWVHXAYPEXNZSZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-hydroxypropanoic acid |
| InChIKey | HWVHXAYPEXNZSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)O)Cl |
Computed by PubChem (NCBI)